C30H55N3O12S — CID 91574980
2-methyl-2-(2-methylbutanoylamino)propane-1-sulfonate;2-(2-methylprop-2-enoyloxy)ethylazanium;2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethyl 2,2-dimethylbutanoate (PubChem CID 91574980) has the molecular formula C30H55N3O12S and a molecular weight of 681.85 g/mol. Its IUPAC name is 2-methyl-2-(2-methylbutanoylamino)propane-1-sulfonate;2-(2-methylprop-2-enoyloxy)ethylazanium;2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethyl 2,2-dimethylbutanoate.
| Compound Name | 2-methyl-2-(2-methylbutanoylamino)propane-1-sulfonate;2-(2-methylprop-2-enoyloxy)ethylazanium;2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 91574980 |
| Molecular Formula | C30H55N3O12S |
| Molecular Weight | 681.85 g/mol |
| Exact Mass | 681.35 |
| IUPAC Name | 2-methyl-2-(2-methylbutanoylamino)propane-1-sulfonate;2-(2-methylprop-2-enoyloxy)ethylazanium;2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethyl 2,2-dimethylbutanoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCCOC(=O)C(C)(C)CC.C=C(C)C(=O)OCC[NH3+].CCC(C)C(=O)NC(C)(C)CS(=O)(=O)[O-] |
| InChI | InChI=1S/C15H25NO6.C9H19NO4S.C6H11NO2/c1-6-15(4,5)13(18)21-9-10-22-14(19)16-7-8-20-12(17)11(2)3;1-5-7(2)8(11)10-9(3,4)6-15(12,13)14;1-5(2)6(8)9-4-3-7/h2,6-10H2,1,3-5H3,(H,16,19);7H,5-6H2,1-4H3,(H,10,11)(H,12,13,14);1,3-4,7H2,2H3 |
| InChIKey | GTQBFBALRDGWIA-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 231.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.85 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|