C16H32N2O6S — CID 123265095
2-(2,2-dimethylbutanoylamino)-2-methylpropane-1-sulfonate;2-(2-methylprop-2-enoyloxy)ethylazanium (PubChem CID 123265095) has the molecular formula C16H32N2O6S and a molecular weight of 380.51 g/mol. Its IUPAC name is 2-(2,2-dimethylbutanoylamino)-2-methylpropane-1-sulfonate;2-(2-methylprop-2-enoyloxy)ethylazanium.
| Compound Name | 2-(2,2-dimethylbutanoylamino)-2-methylpropane-1-sulfonate;2-(2-methylprop-2-enoyloxy)ethylazanium |
|---|---|
| PubChem CID | 123265095 |
| Molecular Formula | C16H32N2O6S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 2-(2,2-dimethylbutanoylamino)-2-methylpropane-1-sulfonate;2-(2-methylprop-2-enoyloxy)ethylazanium |
| SMILES | C=C(C)C(=O)OCC[NH3+].CCC(C)(C)C(=O)NC(C)(C)CS(=O)(=O)[O-] |
| InChI | InChI=1S/C10H21NO4S.C6H11NO2/c1-6-9(2,3)8(12)11-10(4,5)7-16(13,14)15;1-5(2)6(8)9-4-3-7/h6-7H2,1-5H3,(H,11,12)(H,13,14,15);1,3-4,7H2,2H3 |
| InChIKey | ATVYFUIJQZRTBN-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 140.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|