C18H36N2O6S — CID 91054062
2-(dimethylamino)ethyl 2-methylprop-2-enoate;2-(2,2-dimethylbutanoylamino)-2-methylpropane-1-sulfonic acid (PubChem CID 91054062) has the molecular formula C18H36N2O6S and a molecular weight of 408.56 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2-methylprop-2-enoate;2-(2,2-dimethylbutanoylamino)-2-methylpropane-1-sulfonic acid.
| Compound Name | 2-(dimethylamino)ethyl 2-methylprop-2-enoate;2-(2,2-dimethylbutanoylamino)-2-methylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 91054062 |
| Molecular Formula | C18H36N2O6S |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 2-(dimethylamino)ethyl 2-methylprop-2-enoate;2-(2,2-dimethylbutanoylamino)-2-methylpropane-1-sulfonic acid |
| SMILES | C=C(C)C(=O)OCCN(C)C.CCC(C)(C)C(=O)NC(C)(C)CS(=O)(=O)O |
| InChI | InChI=1S/C10H21NO4S.C8H15NO2/c1-6-9(2,3)8(12)11-10(4,5)7-16(13,14)15;1-7(2)8(10)11-6-5-9(3)4/h6-7H2,1-5H3,(H,11,12)(H,13,14,15);1,5-6H2,2-4H3 |
| InChIKey | FNBMEYNXCQYOFC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|