C18H38NO10PS — CID 90784070
2-(2,2-dimethylbutanoylamino)-2-methylpropane-1-sulfonic acid;2-phosphonooxyethyl 2,2-dimethylbutanoate (PubChem CID 90784070) has the molecular formula C18H38NO10PS and a molecular weight of 491.54 g/mol. Its IUPAC name is 2-(2,2-dimethylbutanoylamino)-2-methylpropane-1-sulfonic acid;2-phosphonooxyethyl 2,2-dimethylbutanoate.
| Compound Name | 2-(2,2-dimethylbutanoylamino)-2-methylpropane-1-sulfonic acid;2-phosphonooxyethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 90784070 |
| Molecular Formula | C18H38NO10PS |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | 2-(2,2-dimethylbutanoylamino)-2-methylpropane-1-sulfonic acid;2-phosphonooxyethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)NC(C)(C)CS(=O)(=O)O.CCC(C)(C)C(=O)OCCOP(=O)(O)O |
| InChI | InChI=1S/C10H21NO4S.C8H17O6P/c1-6-9(2,3)8(12)11-10(4,5)7-16(13,14)15;1-4-8(2,3)7(9)13-5-6-14-15(10,11)12/h6-7H2,1-5H3,(H,11,12)(H,13,14,15);4-6H2,1-3H3,(H2,10,11,12) |
| InChIKey | PYXMSAAPSPKLFN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 176.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|