C11H21NO7S — CID 58836329
2-[2-(2,2-dimethylbutanoyloxy)ethoxycarbonylamino]ethanesulfonic acid (PubChem CID 58836329) has the molecular formula C11H21NO7S and a molecular weight of 311.36 g/mol. Its IUPAC name is 2-[2-(2,2-dimethylbutanoyloxy)ethoxycarbonylamino]ethanesulfonic acid.
| Compound Name | 2-[2-(2,2-dimethylbutanoyloxy)ethoxycarbonylamino]ethanesulfonic acid |
|---|---|
| PubChem CID | 58836329 |
| Molecular Formula | C11H21NO7S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 2-[2-(2,2-dimethylbutanoyloxy)ethoxycarbonylamino]ethanesulfonic acid |
| SMILES | CCC(C)(C)C(=O)OCCOC(=O)NCCS(=O)(=O)O |
| InChI | InChI=1S/C11H21NO7S/c1-4-11(2,3)9(13)18-6-7-19-10(14)12-5-8-20(15,16)17/h4-8H2,1-3H3,(H,12,14)(H,15,16,17) |
| InChIKey | INSOBNATUSZKAJ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|