C10H21NO5S — CID 162505436
3-(3,3-dimethylbutoxycarbonylamino)propane-1-sulfonic acid (PubChem CID 162505436) has the molecular formula C10H21NO5S and a molecular weight of 267.35 g/mol. Its IUPAC name is 3-(3,3-dimethylbutoxycarbonylamino)propane-1-sulfonic acid.
| Compound Name | 3-(3,3-dimethylbutoxycarbonylamino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 162505436 |
| Molecular Formula | C10H21NO5S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 3-(3,3-dimethylbutoxycarbonylamino)propane-1-sulfonic acid |
| SMILES | CC(C)(C)CCOC(=O)NCCCS(=O)(=O)O |
| InChI | InChI=1S/C10H21NO5S/c1-10(2,3)5-7-16-9(12)11-6-4-8-17(13,14)15/h4-8H2,1-3H3,(H,11,12)(H,13,14,15) |
| InChIKey | IQMSSIYOXJKBCK-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|