C10H19NO5S — CID 166654456
3-[(4,4-dimethyl-5-oxopentanoyl)amino]propane-1-sulfonic acid (PubChem CID 166654456) has the molecular formula C10H19NO5S and a molecular weight of 265.33 g/mol. Its IUPAC name is 3-[(4,4-dimethyl-5-oxopentanoyl)amino]propane-1-sulfonic acid.
| Compound Name | 3-[(4,4-dimethyl-5-oxopentanoyl)amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 166654456 |
| Molecular Formula | C10H19NO5S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 3-[(4,4-dimethyl-5-oxopentanoyl)amino]propane-1-sulfonic acid |
| SMILES | CC(C)(C=O)CCC(=O)NCCCS(=O)(=O)O |
| InChI | InChI=1S/C10H19NO5S/c1-10(2,8-12)5-4-9(13)11-6-3-7-17(14,15)16/h8H,3-7H2,1-2H3,(H,11,13)(H,14,15,16) |
| InChIKey | TVVYNIDKMKFEQI-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|