C13H23F2NO4 — CID 89446879
2-(3,3-difluorobutoxycarbonylamino)ethyl 2,2-dimethylbutanoate (PubChem CID 89446879) has the molecular formula C13H23F2NO4 and a molecular weight of 295.33 g/mol. Its IUPAC name is 2-(3,3-difluorobutoxycarbonylamino)ethyl 2,2-dimethylbutanoate.
| Compound Name | 2-(3,3-difluorobutoxycarbonylamino)ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 89446879 |
| Molecular Formula | C13H23F2NO4 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 2-(3,3-difluorobutoxycarbonylamino)ethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCNC(=O)OCCC(C)(F)F |
| InChI | InChI=1S/C13H23F2NO4/c1-5-12(2,3)10(17)19-9-7-16-11(18)20-8-6-13(4,14)15/h5-9H2,1-4H3,(H,16,18) |
| InChIKey | MTWRCBIEACDHPN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|