C11H19NO6S — CID 58226155
[2-oxo-2-[2-(sulfanyloxycarbonylamino)ethoxy]ethyl] 2,2-dimethylbutanoate (PubChem CID 58226155) has the molecular formula C11H19NO6S and a molecular weight of 293.34 g/mol. Its IUPAC name is [2-oxo-2-[2-(sulfanyloxycarbonylamino)ethoxy]ethyl] 2,2-dimethylbutanoate.
| Compound Name | [2-oxo-2-[2-(sulfanyloxycarbonylamino)ethoxy]ethyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58226155 |
| Molecular Formula | C11H19NO6S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | [2-oxo-2-[2-(sulfanyloxycarbonylamino)ethoxy]ethyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC(=O)OCCNC(=O)OS |
| InChI | InChI=1S/C11H19NO6S/c1-4-11(2,3)9(14)17-7-8(13)16-6-5-12-10(15)18-19/h19H,4-7H2,1-3H3,(H,12,15) |
| InChIKey | YIXINZHSRWMSAK-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|