C17H31NO6 — CID 140943165
1-O-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl] 4-O-propyl 2-ethyl-2-methylbutanedioate (PubChem CID 140943165) has the molecular formula C17H31NO6 and a molecular weight of 345.44 g/mol. Its IUPAC name is 1-O-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl] 4-O-propyl 2-ethyl-2-methylbutanedioate.
| Compound Name | 1-O-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl] 4-O-propyl 2-ethyl-2-methylbutanedioate |
|---|---|
| PubChem CID | 140943165 |
| Molecular Formula | C17H31NO6 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 1-O-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl] 4-O-propyl 2-ethyl-2-methylbutanedioate |
| SMILES | CCCOC(=O)CC(C)(CC)C(=O)OCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H31NO6/c1-7-10-22-13(19)12-17(6,8-2)14(20)23-11-9-18-15(21)24-16(3,4)5/h7-12H2,1-6H3,(H,18,21) |
| InChIKey | NVGGYLXIYSHSHU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|