C9H16NNaO6S — CID 21020860
sodium [2-(2,2-dimethylbutanoyloxy)ethylamino]-oxomethanesulfonate (PubChem CID 21020860) has the molecular formula C9H16NNaO6S and a molecular weight of 289.29 g/mol. Its IUPAC name is sodium [2-(2,2-dimethylbutanoyloxy)ethylamino]-oxomethanesulfonate.
| Compound Name | sodium [2-(2,2-dimethylbutanoyloxy)ethylamino]-oxomethanesulfonate |
|---|---|
| PubChem CID | 21020860 |
| Molecular Formula | C9H16NNaO6S |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | sodium [2-(2,2-dimethylbutanoyloxy)ethylamino]-oxomethanesulfonate |
| SMILES | CCC(C)(C)C(=O)OCCNC(=O)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C9H17NO6S.Na/c1-4-9(2,3)7(11)16-6-5-10-8(12)17(13,14)15;/h4-6H2,1-3H3,(H,10,12)(H,13,14,15);/q;+1/p-1 |
| InChIKey | IQUNSYAWRHOBPU-UHFFFAOYSA-M |
| XLogP | -2.78 |
| TPSA | 112.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|