C11H20NNaO6S — CID 58836326
sodium 2-[3-(2,2-dimethylbutanoyloxy)propanoylamino]ethanesulfonate (PubChem CID 58836326) has the molecular formula C11H20NNaO6S and a molecular weight of 317.34 g/mol. Its IUPAC name is sodium 2-[3-(2,2-dimethylbutanoyloxy)propanoylamino]ethanesulfonate.
| Compound Name | sodium 2-[3-(2,2-dimethylbutanoyloxy)propanoylamino]ethanesulfonate |
|---|---|
| PubChem CID | 58836326 |
| Molecular Formula | C11H20NNaO6S |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | sodium 2-[3-(2,2-dimethylbutanoyloxy)propanoylamino]ethanesulfonate |
| SMILES | CCC(C)(C)C(=O)OCCC(=O)NCCS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C11H21NO6S.Na/c1-4-11(2,3)10(14)18-7-5-9(13)12-6-8-19(15,16)17;/h4-8H2,1-3H3,(H,12,13)(H,15,16,17);/q;+1/p-1 |
| InChIKey | VQVQWXUFJUVXRL-UHFFFAOYSA-M |
| XLogP | -2.98 |
| TPSA | 112.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | -2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|