C23H41NO9 — CID 91147107
2-hydroxyethyl 2,2-dimethylbutanoate;2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethyl 2,2-dimethylbutanoate (PubChem CID 91147107) has the molecular formula C23H41NO9 and a molecular weight of 475.58 g/mol. Its IUPAC name is 2-hydroxyethyl 2,2-dimethylbutanoate;2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethyl 2,2-dimethylbutanoate.
| Compound Name | 2-hydroxyethyl 2,2-dimethylbutanoate;2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 91147107 |
| Molecular Formula | C23H41NO9 |
| Molecular Weight | 475.58 g/mol |
| Exact Mass | 475.28 |
| IUPAC Name | 2-hydroxyethyl 2,2-dimethylbutanoate;2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethyl 2,2-dimethylbutanoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCCOC(=O)C(C)(C)CC.CCC(C)(C)C(=O)OCCO |
| InChI | InChI=1S/C15H25NO6.C8H16O3/c1-6-15(4,5)13(18)21-9-10-22-14(19)16-7-8-20-12(17)11(2)3;1-4-8(2,3)7(10)11-6-5-9/h2,6-10H2,1,3-5H3,(H,16,19);9H,4-6H2,1-3H3 |
| InChIKey | FHIIHCNHUWUPRH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.58 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|