C23H41NO8 — CID 153467663
2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethyl 4-ethyl-5-hydroperoxy-2,2,4-trimethylnonanoate (PubChem CID 153467663) has the molecular formula C23H41NO8 and a molecular weight of 459.58 g/mol. Its IUPAC name is 2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethyl 4-ethyl-5-hydroperoxy-2,2,4-trimethylnonanoate.
| Compound Name | 2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethyl 4-ethyl-5-hydroperoxy-2,2,4-trimethylnonanoate |
|---|---|
| PubChem CID | 153467663 |
| Molecular Formula | C23H41NO8 |
| Molecular Weight | 459.58 g/mol |
| Exact Mass | 459.28 |
| IUPAC Name | 2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethyl 4-ethyl-5-hydroperoxy-2,2,4-trimethylnonanoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCCOC(=O)C(C)(C)CC(C)(CC)C(CCCC)OO |
| InChI | InChI=1S/C23H41NO8/c1-8-10-11-18(32-28)23(7,9-2)16-22(5,6)20(26)30-14-15-31-21(27)24-12-13-29-19(25)17(3)4/h18,28H,3,8-16H2,1-2,4-7H3,(H,24,27) |
| InChIKey | RPWXBAZLNSURQI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.58 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|