C28H48NO14P — CID 126492984
2-[(2S)-2-acetyl-2-ethyl-4-(2-hydroxyethoxycarbonyl)-4,6,6-trimethyl-7-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethoxy]-7-oxoheptoxy]ethylphosphonic acid (PubChem CID 126492984) has the molecular formula C28H48NO14P and a molecular weight of 653.66 g/mol. Its IUPAC name is 2-[(2S)-2-acetyl-2-ethyl-4-(2-hydroxyethoxycarbonyl)-4,6,6-trimethyl-7-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethoxy]-7-oxoheptoxy]ethylphosphonic acid.
| Compound Name | 2-[(2S)-2-acetyl-2-ethyl-4-(2-hydroxyethoxycarbonyl)-4,6,6-trimethyl-7-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethoxy]-7-oxoheptoxy]ethylphosphonic acid |
|---|---|
| PubChem CID | 126492984 |
| Molecular Formula | C28H48NO14P |
| Molecular Weight | 653.66 g/mol |
| Exact Mass | 653.28 |
| IUPAC Name | 2-[(2S)-2-acetyl-2-ethyl-4-(2-hydroxyethoxycarbonyl)-4,6,6-trimethyl-7-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethoxy]-7-oxoheptoxy]ethylphosphonic acid |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCCOC(=O)C(C)(C)CC(C)(C[C@@](CC)(COCCP(=O)(O)O)C(C)=O)C(=O)OCCO |
| InChI | InChI=1S/C28H48NO14P/c1-8-28(21(4)31,19-39-15-16-44(36,37)38)18-27(7,24(34)41-12-10-30)17-26(5,6)23(33)42-13-14-43-25(35)29-9-11-40-22(32)20(2)3/h30H,2,8-19H2,1,3-7H3,(H,29,35)(H2,36,37,38)/t27?,28-/m0/s1 |
| InChIKey | UOUCAHNKNLXPOX-CPRJBALCSA-N |
| XLogP | 1.90 |
| TPSA | 221.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.66 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|