C10H17NO6 — CID 58226144
[2-oxo-2-[(tritiooxycarbonylamino)methoxy]ethyl] 2,2-dimethylbutanoate (PubChem CID 58226144) has the molecular formula C10H17NO6 and a molecular weight of 249.26 g/mol. Its IUPAC name is [2-oxo-2-[(tritiooxycarbonylamino)methoxy]ethyl] 2,2-dimethylbutanoate.
| Compound Name | [2-oxo-2-[(tritiooxycarbonylamino)methoxy]ethyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58226144 |
| Molecular Formula | C10H17NO6 |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | [2-oxo-2-[(tritiooxycarbonylamino)methoxy]ethyl] 2,2-dimethylbutanoate |
| SMILES | [3H]OC(=O)NCOC(=O)COC(=O)C(C)(C)CC |
| InChI | InChI=1S/C10H17NO6/c1-4-10(2,3)8(13)16-5-7(12)17-6-11-9(14)15/h11H,4-6H2,1-3H3,(H,14,15)/i/hT |
| InChIKey | ZOQOEXCRWUGSBP-MNYXATJNSA-N |
| XLogP | 0.73 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|