C17H22NO6- — CID 140856684
4-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyloxymethyl]benzoate (PubChem CID 140856684) has the molecular formula C17H22NO6- and a molecular weight of 336.36 g/mol. Its IUPAC name is 4-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyloxymethyl]benzoate.
| Compound Name | 4-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyloxymethyl]benzoate |
|---|---|
| PubChem CID | 140856684 |
| Molecular Formula | C17H22NO6- |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 4-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyloxymethyl]benzoate |
| SMILES | CCC(C)(C)C(=O)OCCNC(=O)OCc1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C17H23NO6/c1-4-17(2,3)15(21)23-10-9-18-16(22)24-11-12-5-7-13(8-6-12)14(19)20/h5-8H,4,9-11H2,1-3H3,(H,18,22)(H,19,20)/p-1 |
| InChIKey | RQSBAPUQCPMIQO-UHFFFAOYSA-M |
| XLogP | 1.26 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|