C24H27NO6 — CID 20663791
2-[[4-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]phenoxy]carbonylamino]ethyl 2,2-dimethylbutanoate (PubChem CID 20663791) has the molecular formula C24H27NO6 and a molecular weight of 425.48 g/mol. Its IUPAC name is 2-[[4-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]phenoxy]carbonylamino]ethyl 2,2-dimethylbutanoate.
| Compound Name | 2-[[4-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]phenoxy]carbonylamino]ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 20663791 |
| Molecular Formula | C24H27NO6 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 2-[[4-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]phenoxy]carbonylamino]ethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCNC(=O)Oc1ccc(C(=O)/C=C/c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C24H27NO6/c1-4-24(2,3)22(28)30-16-15-25-23(29)31-20-12-8-18(9-13-20)21(27)14-7-17-5-10-19(26)11-6-17/h5-14,26H,4,15-16H2,1-3H3,(H,25,29)/b14-7+ |
| InChIKey | OKBKUWMJFKJEEA-VGOFMYFVSA-N |
| XLogP | 4.36 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|