C17H22O4 — CID 121352960
[4-[(E)-3-oxobut-1-enyl]phenoxy]methyl 2,2-dimethylbutanoate (PubChem CID 121352960) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is [4-[(E)-3-oxobut-1-enyl]phenoxy]methyl 2,2-dimethylbutanoate.
| Compound Name | [4-[(E)-3-oxobut-1-enyl]phenoxy]methyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 121352960 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | [4-[(E)-3-oxobut-1-enyl]phenoxy]methyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCOc1ccc(/C=C/C(C)=O)cc1 |
| InChI | InChI=1S/C17H22O4/c1-5-17(3,4)16(19)21-12-20-15-10-8-14(9-11-15)7-6-13(2)18/h6-11H,5,12H2,1-4H3/b7-6+ |
| InChIKey | YBHXJVJOJJMXFW-VOTSOKGWSA-N |
| XLogP | 3.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|