C33H38O6 — CID 153457404
[4-[3-[4-(4-methoxyphenyl)phenyl]prop-2-enoyloxy]phenoxy]methyl 2,4-dimethyl-2-propan-2-ylpentanoate (PubChem CID 153457404) has the molecular formula C33H38O6 and a molecular weight of 530.66 g/mol. Its IUPAC name is [4-[3-[4-(4-methoxyphenyl)phenyl]prop-2-enoyloxy]phenoxy]methyl 2,4-dimethyl-2-propan-2-ylpentanoate.
| Compound Name | [4-[3-[4-(4-methoxyphenyl)phenyl]prop-2-enoyloxy]phenoxy]methyl 2,4-dimethyl-2-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 153457404 |
| Molecular Formula | C33H38O6 |
| Molecular Weight | 530.66 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | [4-[3-[4-(4-methoxyphenyl)phenyl]prop-2-enoyloxy]phenoxy]methyl 2,4-dimethyl-2-propan-2-ylpentanoate |
| SMILES | COc1ccc(-c2ccc(C=CC(=O)Oc3ccc(OCOC(=O)C(C)(CC(C)C)C(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H38O6/c1-23(2)21-33(5,24(3)4)32(35)38-22-37-29-16-18-30(19-17-29)39-31(34)20-9-25-7-10-26(11-8-25)27-12-14-28(36-6)15-13-27/h7-20,23-24H,21-22H2,1-6H3 |
| InChIKey | GCQSLXRVEJTREQ-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.66 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|