C44H41NO5 — CID 157339161
[4-[2-[4-[2-[4-[(E)-3-(4-cyanophenyl)prop-2-enoyl]oxyphenyl]ethynyl]-3-methylphenyl]ethynyl]phenoxy]methyl 2,4-dimethyl-2-propan-2-ylpentanoate (PubChem CID 157339161) has the molecular formula C44H41NO5 and a molecular weight of 663.81 g/mol. Its IUPAC name is [4-[2-[4-[2-[4-[(E)-3-(4-cyanophenyl)prop-2-enoyl]oxyphenyl]ethynyl]-3-methylphenyl]ethynyl]phenoxy]methyl 2,4-dimethyl-2-propan-2-ylpentanoate.
| Compound Name | [4-[2-[4-[2-[4-[(E)-3-(4-cyanophenyl)prop-2-enoyl]oxyphenyl]ethynyl]-3-methylphenyl]ethynyl]phenoxy]methyl 2,4-dimethyl-2-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 157339161 |
| Molecular Formula | C44H41NO5 |
| Molecular Weight | 663.81 g/mol |
| Exact Mass | 663.30 |
| IUPAC Name | [4-[2-[4-[2-[4-[(E)-3-(4-cyanophenyl)prop-2-enoyl]oxyphenyl]ethynyl]-3-methylphenyl]ethynyl]phenoxy]methyl 2,4-dimethyl-2-propan-2-ylpentanoate |
| SMILES | Cc1cc(C#Cc2ccc(OCOC(=O)C(C)(CC(C)C)C(C)C)cc2)ccc1C#Cc1ccc(OC(=O)/C=C/c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C44H41NO5/c1-31(2)28-44(6,32(3)4)43(47)49-30-48-40-22-15-35(16-23-40)7-10-37-14-21-39(33(5)27-37)20-13-36-17-24-41(25-18-36)50-42(46)26-19-34-8-11-38(29-45)12-9-34/h8-9,11-12,14-19,21-27,31-32H,28,30H2,1-6H3/b26-19+ |
| InChIKey | KYLLSDXOZCYLQX-LGUFXXKBSA-N |
| XLogP | 8.87 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.81 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|