C48H45NO9 — CID 59668531
5-O-[4-[4-[4-(4-cyanophenyl)phenoxy]carbonylphenoxy]butyl] 1-O-[4-[(E)-3-phenylprop-2-enoyl]oxyphenyl] 2-ethyl-2,4-dimethylpentanedioate (PubChem CID 59668531) has the molecular formula C48H45NO9 and a molecular weight of 779.89 g/mol. Its IUPAC name is 5-O-[4-[4-[4-(4-cyanophenyl)phenoxy]carbonylphenoxy]butyl] 1-O-[4-[(E)-3-phenylprop-2-enoyl]oxyphenyl] 2-ethyl-2,4-dimethylpentanedioate.
| Compound Name | 5-O-[4-[4-[4-(4-cyanophenyl)phenoxy]carbonylphenoxy]butyl] 1-O-[4-[(E)-3-phenylprop-2-enoyl]oxyphenyl] 2-ethyl-2,4-dimethylpentanedioate |
|---|---|
| PubChem CID | 59668531 |
| Molecular Formula | C48H45NO9 |
| Molecular Weight | 779.89 g/mol |
| Exact Mass | 779.31 |
| IUPAC Name | 5-O-[4-[4-[4-(4-cyanophenyl)phenoxy]carbonylphenoxy]butyl] 1-O-[4-[(E)-3-phenylprop-2-enoyl]oxyphenyl] 2-ethyl-2,4-dimethylpentanedioate |
| SMILES | CCC(C)(CC(C)C(=O)OCCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(C#N)cc3)cc2)cc1)C(=O)Oc1ccc(OC(=O)/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C48H45NO9/c1-4-48(3,47(53)58-43-27-25-41(26-28-43)56-44(50)29-14-35-10-6-5-7-11-35)32-34(2)45(51)55-31-9-8-30-54-40-21-19-39(20-22-40)46(52)57-42-23-17-38(18-24-42)37-15-12-36(33-49)13-16-37/h5-7,10-29,34H,4,8-9,30-32H2,1-3H3/b29-14+ |
| InChIKey | UHJZUYSKOBHMGT-IPPBACCNSA-N |
| XLogP | 9.81 |
| TPSA | 138.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.89 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|