C19H15NO3 — CID 59273690
[4-[2-(4-cyanophenyl)ethenyl]phenoxy]methyl prop-2-enoate (PubChem CID 59273690) has the molecular formula C19H15NO3 and a molecular weight of 305.33 g/mol. Its IUPAC name is [4-[2-(4-cyanophenyl)ethenyl]phenoxy]methyl prop-2-enoate.
| Compound Name | [4-[2-(4-cyanophenyl)ethenyl]phenoxy]methyl prop-2-enoate |
|---|---|
| PubChem CID | 59273690 |
| Molecular Formula | C19H15NO3 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | [4-[2-(4-cyanophenyl)ethenyl]phenoxy]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCOc1ccc(C=Cc2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C19H15NO3/c1-2-19(21)23-14-22-18-11-9-16(10-12-18)4-3-15-5-7-17(13-20)8-6-15/h2-12H,1,14H2 |
| InChIKey | CHGOQRNBBVZZEG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|