C13H18O5 — CID 158280789
methane;4-(prop-2-enoyloxymethoxy)benzoic acid (PubChem CID 158280789) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is methane;4-(prop-2-enoyloxymethoxy)benzoic acid.
| Compound Name | methane;4-(prop-2-enoyloxymethoxy)benzoic acid |
|---|---|
| PubChem CID | 158280789 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | methane;4-(prop-2-enoyloxymethoxy)benzoic acid |
| SMILES | C.C.C=CC(=O)OCOc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C11H10O5.2CH4/c1-2-10(12)16-7-15-9-5-3-8(4-6-9)11(13)14;;/h2-6H,1,7H2,(H,13,14);2*1H4 |
| InChIKey | GKEKMCIPPYNWCV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|