About [4-[4-(prop-2-enoyloxymethoxy)phenoxy]carbonylphenyl] 4-prop-2-enoxybenzoate
[4-[4-(prop-2-enoyloxymethoxy)phenoxy]carbonylphenyl] 4-prop-2-enoxybenzoate (PubChem CID 129081661) has the molecular formula C27H22O8
and a molecular weight of 474.47 g/mol. Its IUPAC name is [4-[4-(prop-2-enoyloxymethoxy)phenoxy]carbonylphenyl] 4-prop-2-enoxybenzoate.
Molecular Properties
| Compound Name | [4-[4-(prop-2-enoyloxymethoxy)phenoxy]carbonylphenyl] 4-prop-2-enoxybenzoate |
| PubChem CID | 129081661 |
| Molecular Formula | C27H22O8 |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | [4-[4-(prop-2-enoyloxymethoxy)phenoxy]carbonylphenyl] 4-prop-2-enoxybenzoate |
| SMILES | C=CCOc1ccc(C(=O)Oc2ccc(C(=O)Oc3ccc(OCOC(=O)C=C)cc3)cc2)cc1 |
| InChI | InChI=1S/C27H22O8/c1-3-17-31-21-9-5-19(6-10-21)26(29)34-23-11-7-20(8-12-23)27(30)35-24-15-13-22(14-16-24)32-18-33-25(28)4-2/h3-16H,1-2,17-18H2 |
| InChIKey | UGMQBSCVSGTBSR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[4-(prop-2-enoyloxymethoxy)phenoxy]carbonylphenyl] 4-prop-2-enoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-(prop-2-enoyloxymethoxy)phenoxy]carbonylphenyl] 4-prop-2-enoxybenzoate?
The IUPAC name of [4-[4-(prop-2-enoyloxymethoxy)phenoxy]carbonylphenyl] 4-prop-2-enoxybenzoate (CID 129081661) is [4-[4-(prop-2-enoyloxymethoxy)phenoxy]carbonylphenyl] 4-prop-2-enoxybenzoate.
What is the SMILES notation for [4-[4-(prop-2-enoyloxymethoxy)phenoxy]carbonylphenyl] 4-prop-2-enoxybenzoate?
The canonical SMILES for [4-[4-(prop-2-enoyloxymethoxy)phenoxy]carbonylphenyl] 4-prop-2-enoxybenzoate is C=CCOc1ccc(C(=O)Oc2ccc(C(=O)Oc3ccc(OCOC(=O)C=C)cc3)cc2)cc1.
What is the InChIKey of [4-[4-(prop-2-enoyloxymethoxy)phenoxy]carbonylphenyl] 4-prop-2-enoxybenzoate?
The InChIKey is UGMQBSCVSGTBSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H22O8/c1-3-17-31-21-9-5-19(6-10-21)26(29)34-23-11-7-20(8-12-23)27(30)35-24-15-13-22(14-16-24)32-18-33-25(28)4-2/h3-16H,1-2,17-18H2.
What are the key properties of [4-[4-(prop-2-enoyloxymethoxy)phenoxy]carbonylphenyl] 4-prop-2-enoxybenzoate?
[4-[4-(prop-2-enoyloxymethoxy)phenoxy]carbonylphenyl] 4-prop-2-enoxybenzoate has a molecular weight of 474.47 g/mol, XLogP of 4.76, 11 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-(prop-2-enoyloxymethoxy)phenoxy]carbonylphenyl] 4-prop-2-enoxybenzoate is sourced from PubChem (CID 129081661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).