C19H17NO3 — CID 59273684
[4-[2-(4-cyanophenyl)ethyl]phenoxy]methyl prop-2-enoate (PubChem CID 59273684) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is [4-[2-(4-cyanophenyl)ethyl]phenoxy]methyl prop-2-enoate.
| Compound Name | [4-[2-(4-cyanophenyl)ethyl]phenoxy]methyl prop-2-enoate |
|---|---|
| PubChem CID | 59273684 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | [4-[2-(4-cyanophenyl)ethyl]phenoxy]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCOc1ccc(CCc2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C19H17NO3/c1-2-19(21)23-14-22-18-11-9-16(10-12-18)4-3-15-5-7-17(13-20)8-6-15/h2,5-12H,1,3-4,14H2 |
| InChIKey | PDILKZVNMXOZBM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|