C31H29F3O6 — CID 21036061
[4-[2-[4-[2-[4-(prop-2-enoyloxymethoxy)phenyl]ethyl]-3-(trifluoromethyl)phenyl]ethyl]phenoxy]methyl prop-2-enoate (PubChem CID 21036061) has the molecular formula C31H29F3O6 and a molecular weight of 554.56 g/mol. Its IUPAC name is [4-[2-[4-[2-[4-(prop-2-enoyloxymethoxy)phenyl]ethyl]-3-(trifluoromethyl)phenyl]ethyl]phenoxy]methyl prop-2-enoate.
| Compound Name | [4-[2-[4-[2-[4-(prop-2-enoyloxymethoxy)phenyl]ethyl]-3-(trifluoromethyl)phenyl]ethyl]phenoxy]methyl prop-2-enoate |
|---|---|
| PubChem CID | 21036061 |
| Molecular Formula | C31H29F3O6 |
| Molecular Weight | 554.56 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | [4-[2-[4-[2-[4-(prop-2-enoyloxymethoxy)phenyl]ethyl]-3-(trifluoromethyl)phenyl]ethyl]phenoxy]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCOc1ccc(CCc2ccc(CCc3ccc(OCOC(=O)C=C)cc3)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C31H29F3O6/c1-3-29(35)39-20-37-26-15-9-22(10-16-26)5-6-24-8-14-25(28(19-24)31(32,33)34)13-7-23-11-17-27(18-12-23)38-21-40-30(36)4-2/h3-4,8-12,14-19H,1-2,5-7,13,20-21H2 |
| InChIKey | KKAWWNMHFFHSBE-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.56 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|