C36H36F6O5 — CID 89021164
8-[4-[4-[2-(4-prop-2-enoyloxyphenyl)ethyl]-2,3-bis(trifluoromethyl)phenyl]phenoxy]octyl prop-2-enoate (PubChem CID 89021164) has the molecular formula C36H36F6O5 and a molecular weight of 662.67 g/mol. Its IUPAC name is 8-[4-[4-[2-(4-prop-2-enoyloxyphenyl)ethyl]-2,3-bis(trifluoromethyl)phenyl]phenoxy]octyl prop-2-enoate.
| Compound Name | 8-[4-[4-[2-(4-prop-2-enoyloxyphenyl)ethyl]-2,3-bis(trifluoromethyl)phenyl]phenoxy]octyl prop-2-enoate |
|---|---|
| PubChem CID | 89021164 |
| Molecular Formula | C36H36F6O5 |
| Molecular Weight | 662.67 g/mol |
| Exact Mass | 662.25 |
| IUPAC Name | 8-[4-[4-[2-(4-prop-2-enoyloxyphenyl)ethyl]-2,3-bis(trifluoromethyl)phenyl]phenoxy]octyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCCCOc1ccc(-c2ccc(CCc3ccc(OC(=O)C=C)cc3)c(C(F)(F)F)c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C36H36F6O5/c1-3-31(43)46-24-10-8-6-5-7-9-23-45-28-20-15-26(16-21-28)30-22-17-27(33(35(37,38)39)34(30)36(40,41)42)14-11-25-12-18-29(19-13-25)47-32(44)4-2/h3-4,12-13,15-22H,1-2,5-11,14,23-24H2 |
| InChIKey | ZCDCJSANDCGZOI-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.67 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|