C38H44F2O6 — CID 54436164
6-[4-[2-[2,3-difluoro-4-[4-(6-prop-2-enoyloxyhexoxy)phenyl]phenyl]ethyl]phenoxy]hexyl prop-2-enoate (PubChem CID 54436164) has the molecular formula C38H44F2O6 and a molecular weight of 634.76 g/mol. Its IUPAC name is 6-[4-[2-[2,3-difluoro-4-[4-(6-prop-2-enoyloxyhexoxy)phenyl]phenyl]ethyl]phenoxy]hexyl prop-2-enoate.
| Compound Name | 6-[4-[2-[2,3-difluoro-4-[4-(6-prop-2-enoyloxyhexoxy)phenyl]phenyl]ethyl]phenoxy]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 54436164 |
| Molecular Formula | C38H44F2O6 |
| Molecular Weight | 634.76 g/mol |
| Exact Mass | 634.31 |
| IUPAC Name | 6-[4-[2-[2,3-difluoro-4-[4-(6-prop-2-enoyloxyhexoxy)phenyl]phenyl]ethyl]phenoxy]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(CCc2ccc(-c3ccc(OCCCCCCOC(=O)C=C)cc3)c(F)c2F)cc1 |
| InChI | InChI=1S/C38H44F2O6/c1-3-35(41)45-27-11-7-5-9-25-43-32-20-14-29(15-21-32)13-16-31-19-24-34(38(40)37(31)39)30-17-22-33(23-18-30)44-26-10-6-8-12-28-46-36(42)4-2/h3-4,14-15,17-24H,1-2,5-13,16,25-28H2 |
| InChIKey | WKWAZJHDGADVPU-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.76 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|