C37H40F2O8 — CID 58776394
6-[4-[2,2-difluoro-7-[4-(6-prop-2-enoyloxyhexoxy)phenyl]-1,3-benzodioxol-4-yl]phenoxy]hexyl prop-2-enoate (PubChem CID 58776394) has the molecular formula C37H40F2O8 and a molecular weight of 650.72 g/mol. Its IUPAC name is 6-[4-[2,2-difluoro-7-[4-(6-prop-2-enoyloxyhexoxy)phenyl]-1,3-benzodioxol-4-yl]phenoxy]hexyl prop-2-enoate.
| Compound Name | 6-[4-[2,2-difluoro-7-[4-(6-prop-2-enoyloxyhexoxy)phenyl]-1,3-benzodioxol-4-yl]phenoxy]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 58776394 |
| Molecular Formula | C37H40F2O8 |
| Molecular Weight | 650.72 g/mol |
| Exact Mass | 650.27 |
| IUPAC Name | 6-[4-[2,2-difluoro-7-[4-(6-prop-2-enoyloxyhexoxy)phenyl]-1,3-benzodioxol-4-yl]phenoxy]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(-c2ccc(-c3ccc(OCCCCCCOC(=O)C=C)cc3)c3c2OC(F)(F)O3)cc1 |
| InChI | InChI=1S/C37H40F2O8/c1-3-33(40)44-25-11-7-5-9-23-42-29-17-13-27(14-18-29)31-21-22-32(36-35(31)46-37(38,39)47-36)28-15-19-30(20-16-28)43-24-10-6-8-12-26-45-34(41)4-2/h3-4,13-22H,1-2,5-12,23-26H2 |
| InChIKey | FRHZYQOXSJNLQR-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.72 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|