C46H30F4O18 — CID 58776408
bis[2,2-difluoro-7-[4-(2-prop-2-enoyloxyethoxy)benzoyl]oxy-1,3-benzodioxol-4-yl] benzene-1,4-dicarboxylate (PubChem CID 58776408) has the molecular formula C46H30F4O18 and a molecular weight of 946.72 g/mol. Its IUPAC name is bis[2,2-difluoro-7-[4-(2-prop-2-enoyloxyethoxy)benzoyl]oxy-1,3-benzodioxol-4-yl] benzene-1,4-dicarboxylate.
| Compound Name | bis[2,2-difluoro-7-[4-(2-prop-2-enoyloxyethoxy)benzoyl]oxy-1,3-benzodioxol-4-yl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 58776408 |
| Molecular Formula | C46H30F4O18 |
| Molecular Weight | 946.72 g/mol |
| Exact Mass | 946.14 |
| IUPAC Name | bis[2,2-difluoro-7-[4-(2-prop-2-enoyloxyethoxy)benzoyl]oxy-1,3-benzodioxol-4-yl] benzene-1,4-dicarboxylate |
| SMILES | C=CC(=O)OCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(C(=O)Oc4ccc(OC(=O)c5ccc(OCCOC(=O)C=C)cc5)c5c4OC(F)(F)O5)cc3)c3c2OC(F)(F)O3)cc1 |
| InChI | InChI=1S/C46H30F4O18/c1-3-35(51)59-23-21-57-29-13-9-27(10-14-29)43(55)63-33-19-17-31(37-39(33)67-45(47,48)65-37)61-41(53)25-5-7-26(8-6-25)42(54)62-32-18-20-34(40-38(32)66-46(49,50)68-40)64-44(56)28-11-15-30(16-12-28)58-22-24-60-36(52)4-2/h3-20H,1-2,21-24H2 |
| InChIKey | GGVGLTOYCLUNBP-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 213.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 946.72 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|