C26H22F2O7 — CID 58776453
(2,2-difluoro-7-propoxy-1,3-benzodioxol-4-yl) 6-(2-prop-2-enoyloxyethyl)naphthalene-2-carboxylate (PubChem CID 58776453) has the molecular formula C26H22F2O7 and a molecular weight of 484.45 g/mol. Its IUPAC name is (2,2-difluoro-7-propoxy-1,3-benzodioxol-4-yl) 6-(2-prop-2-enoyloxyethyl)naphthalene-2-carboxylate.
| Compound Name | (2,2-difluoro-7-propoxy-1,3-benzodioxol-4-yl) 6-(2-prop-2-enoyloxyethyl)naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 58776453 |
| Molecular Formula | C26H22F2O7 |
| Molecular Weight | 484.45 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | (2,2-difluoro-7-propoxy-1,3-benzodioxol-4-yl) 6-(2-prop-2-enoyloxyethyl)naphthalene-2-carboxylate |
| SMILES | C=CC(=O)OCCc1ccc2cc(C(=O)Oc3ccc(OCCC)c4c3OC(F)(F)O4)ccc2c1 |
| InChI | InChI=1S/C26H22F2O7/c1-3-12-31-20-9-10-21(24-23(20)34-26(27,28)35-24)33-25(30)19-8-7-17-14-16(5-6-18(17)15-19)11-13-32-22(29)4-2/h4-10,14-15H,2-3,11-13H2,1H3 |
| InChIKey | YYOPNSXTMYUCPU-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.45 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|