C46H44F2O14 — CID 58776212
[4-[4-[[2,2-difluoro-7-(6-prop-2-enoyloxyhexoxy)-1,3-benzodioxol-4-yl]oxycarbonyl]phenoxy]carbonylphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate (PubChem CID 58776212) has the molecular formula C46H44F2O14 and a molecular weight of 858.84 g/mol. Its IUPAC name is [4-[4-[[2,2-difluoro-7-(6-prop-2-enoyloxyhexoxy)-1,3-benzodioxol-4-yl]oxycarbonyl]phenoxy]carbonylphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate.
| Compound Name | [4-[4-[[2,2-difluoro-7-(6-prop-2-enoyloxyhexoxy)-1,3-benzodioxol-4-yl]oxycarbonyl]phenoxy]carbonylphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
|---|---|
| PubChem CID | 58776212 |
| Molecular Formula | C46H44F2O14 |
| Molecular Weight | 858.84 g/mol |
| Exact Mass | 858.27 |
| IUPAC Name | [4-[4-[[2,2-difluoro-7-(6-prop-2-enoyloxyhexoxy)-1,3-benzodioxol-4-yl]oxycarbonyl]phenoxy]carbonylphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(C(=O)Oc3ccc(C(=O)Oc4ccc(OCCCCCCOC(=O)C=C)c5c4OC(F)(F)O5)cc3)cc2)cc1 |
| InChI | InChI=1S/C46H44F2O14/c1-3-39(49)56-29-11-7-5-9-27-54-34-19-13-31(14-20-34)43(51)58-35-21-15-32(16-22-35)44(52)59-36-23-17-33(18-24-36)45(53)60-38-26-25-37(41-42(38)62-46(47,48)61-41)55-28-10-6-8-12-30-57-40(50)4-2/h3-4,13-26H,1-2,5-12,27-30H2 |
| InChIKey | DEGCUMGDUSOMAP-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 168.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.84 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|