C28H20F4O5 — CID 170034770
3-[4-[6-fluoro-7-prop-2-enoyloxy-4-(trifluoromethyl)dibenzofuran-3-yl]phenyl]propyl prop-2-enoate (PubChem CID 170034770) has the molecular formula C28H20F4O5 and a molecular weight of 512.46 g/mol. Its IUPAC name is 3-[4-[6-fluoro-7-prop-2-enoyloxy-4-(trifluoromethyl)dibenzofuran-3-yl]phenyl]propyl prop-2-enoate.
| Compound Name | 3-[4-[6-fluoro-7-prop-2-enoyloxy-4-(trifluoromethyl)dibenzofuran-3-yl]phenyl]propyl prop-2-enoate |
|---|---|
| PubChem CID | 170034770 |
| Molecular Formula | C28H20F4O5 |
| Molecular Weight | 512.46 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | 3-[4-[6-fluoro-7-prop-2-enoyloxy-4-(trifluoromethyl)dibenzofuran-3-yl]phenyl]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCc1ccc(-c2ccc3c(oc4c(F)c(OC(=O)C=C)ccc43)c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C28H20F4O5/c1-3-22(33)35-15-5-6-16-7-9-17(10-8-16)18-11-12-19-20-13-14-21(36-23(34)4-2)25(29)27(20)37-26(19)24(18)28(30,31)32/h3-4,7-14H,1-2,5-6,15H2 |
| InChIKey | CLDOPEIQACLCHJ-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.46 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|