C22H16F4O5 — CID 170034174
3-[4-fluoro-7-prop-2-enoyloxy-6-(trifluoromethyl)dibenzofuran-3-yl]propyl prop-2-enoate (PubChem CID 170034174) has the molecular formula C22H16F4O5 and a molecular weight of 436.36 g/mol. Its IUPAC name is 3-[4-fluoro-7-prop-2-enoyloxy-6-(trifluoromethyl)dibenzofuran-3-yl]propyl prop-2-enoate.
| Compound Name | 3-[4-fluoro-7-prop-2-enoyloxy-6-(trifluoromethyl)dibenzofuran-3-yl]propyl prop-2-enoate |
|---|---|
| PubChem CID | 170034174 |
| Molecular Formula | C22H16F4O5 |
| Molecular Weight | 436.36 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 3-[4-fluoro-7-prop-2-enoyloxy-6-(trifluoromethyl)dibenzofuran-3-yl]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCc1ccc2c(oc3c(C(F)(F)F)c(OC(=O)C=C)ccc32)c1F |
| InChI | InChI=1S/C22H16F4O5/c1-3-16(27)29-11-5-6-12-7-8-14-13-9-10-15(30-17(28)4-2)18(22(24,25)26)20(13)31-21(14)19(12)23/h3-4,7-10H,1-2,5-6,11H2 |
| InChIKey | XWNSYLDFARTWNB-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.36 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|