C22H17F3O4S — CID 170020857
3-[7-prop-2-enoyloxy-4-(trifluoromethyl)dibenzothiophen-3-yl]propyl prop-2-enoate (PubChem CID 170020857) has the molecular formula C22H17F3O4S and a molecular weight of 434.44 g/mol. Its IUPAC name is 3-[7-prop-2-enoyloxy-4-(trifluoromethyl)dibenzothiophen-3-yl]propyl prop-2-enoate.
| Compound Name | 3-[7-prop-2-enoyloxy-4-(trifluoromethyl)dibenzothiophen-3-yl]propyl prop-2-enoate |
|---|---|
| PubChem CID | 170020857 |
| Molecular Formula | C22H17F3O4S |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 3-[7-prop-2-enoyloxy-4-(trifluoromethyl)dibenzothiophen-3-yl]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCc1ccc2c(sc3cc(OC(=O)C=C)ccc32)c1C(F)(F)F |
| InChI | InChI=1S/C22H17F3O4S/c1-3-18(26)28-11-5-6-13-7-9-16-15-10-8-14(29-19(27)4-2)12-17(15)30-21(16)20(13)22(23,24)25/h3-4,7-10,12H,1-2,5-6,11H2 |
| InChIKey | BXKPVCXLJXNZIL-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|