C27H21FO4S — CID 170030848
3-[4-(6-fluoro-7-prop-2-enoyloxydibenzothiophen-3-yl)phenyl]propyl prop-2-enoate (PubChem CID 170030848) has the molecular formula C27H21FO4S and a molecular weight of 460.53 g/mol. Its IUPAC name is 3-[4-(6-fluoro-7-prop-2-enoyloxydibenzothiophen-3-yl)phenyl]propyl prop-2-enoate.
| Compound Name | 3-[4-(6-fluoro-7-prop-2-enoyloxydibenzothiophen-3-yl)phenyl]propyl prop-2-enoate |
|---|---|
| PubChem CID | 170030848 |
| Molecular Formula | C27H21FO4S |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | 3-[4-(6-fluoro-7-prop-2-enoyloxydibenzothiophen-3-yl)phenyl]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCc1ccc(-c2ccc3c(c2)sc2c(F)c(OC(=O)C=C)ccc23)cc1 |
| InChI | InChI=1S/C27H21FO4S/c1-3-24(29)31-15-5-6-17-7-9-18(10-8-17)19-11-12-20-21-13-14-22(32-25(30)4-2)26(28)27(21)33-23(20)16-19/h3-4,7-14,16H,1-2,5-6,15H2 |
| InChIKey | BVDSNDSXJYBDGX-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|