C30H25F3O5S — CID 170022700
3-[4-[7-(2-methylprop-2-enoyloxy)-6-(trifluoromethoxy)dibenzothiophen-3-yl]phenyl]propyl 2-methylprop-2-enoate (PubChem CID 170022700) has the molecular formula C30H25F3O5S and a molecular weight of 554.59 g/mol. Its IUPAC name is 3-[4-[7-(2-methylprop-2-enoyloxy)-6-(trifluoromethoxy)dibenzothiophen-3-yl]phenyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[4-[7-(2-methylprop-2-enoyloxy)-6-(trifluoromethoxy)dibenzothiophen-3-yl]phenyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 170022700 |
| Molecular Formula | C30H25F3O5S |
| Molecular Weight | 554.59 g/mol |
| Exact Mass | 554.14 |
| IUPAC Name | 3-[4-[7-(2-methylprop-2-enoyloxy)-6-(trifluoromethoxy)dibenzothiophen-3-yl]phenyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1ccc(-c2ccc3c(c2)sc2c(OC(F)(F)F)c(OC(=O)C(=C)C)ccc23)cc1 |
| InChI | InChI=1S/C30H25F3O5S/c1-17(2)28(34)36-15-5-6-19-7-9-20(10-8-19)21-11-12-22-23-13-14-24(37-29(35)18(3)4)26(38-30(31,32)33)27(23)39-25(22)16-21/h7-14,16H,1,3,5-6,15H2,2,4H3 |
| InChIKey | GPLSRIBUQUAOMM-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.59 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|