C25H23F3O6S — CID 170021471
3-[4-methoxy-7-(2-methylprop-2-enoyloxy)-6-(trifluoromethoxy)dibenzothiophen-3-yl]propyl 2-methylprop-2-enoate (PubChem CID 170021471) has the molecular formula C25H23F3O6S and a molecular weight of 508.51 g/mol. Its IUPAC name is 3-[4-methoxy-7-(2-methylprop-2-enoyloxy)-6-(trifluoromethoxy)dibenzothiophen-3-yl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[4-methoxy-7-(2-methylprop-2-enoyloxy)-6-(trifluoromethoxy)dibenzothiophen-3-yl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 170021471 |
| Molecular Formula | C25H23F3O6S |
| Molecular Weight | 508.51 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | 3-[4-methoxy-7-(2-methylprop-2-enoyloxy)-6-(trifluoromethoxy)dibenzothiophen-3-yl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1ccc2c(sc3c(OC(F)(F)F)c(OC(=O)C(=C)C)ccc32)c1OC |
| InChI | InChI=1S/C25H23F3O6S/c1-13(2)23(29)32-12-6-7-15-8-9-16-17-10-11-18(33-24(30)14(3)4)20(34-25(26,27)28)22(17)35-21(16)19(15)31-5/h8-11H,1,3,6-7,12H2,2,4-5H3 |
| InChIKey | PQZXPABLVFQEOP-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.51 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|