C21H20O6S — CID 170024961
(4,6-dimethoxy-7-propanoyloxydibenzothiophen-3-yl) 2-methylprop-2-enoate (PubChem CID 170024961) has the molecular formula C21H20O6S and a molecular weight of 400.45 g/mol. Its IUPAC name is (4,6-dimethoxy-7-propanoyloxydibenzothiophen-3-yl) 2-methylprop-2-enoate.
| Compound Name | (4,6-dimethoxy-7-propanoyloxydibenzothiophen-3-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 170024961 |
| Molecular Formula | C21H20O6S |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | (4,6-dimethoxy-7-propanoyloxydibenzothiophen-3-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc2c(sc3c(OC)c(OC(=O)CC)ccc32)c1OC |
| InChI | InChI=1S/C21H20O6S/c1-6-16(22)26-14-9-7-12-13-8-10-15(27-21(23)11(2)3)18(25-5)20(13)28-19(12)17(14)24-4/h7-10H,2,6H2,1,3-5H3 |
| InChIKey | CCGJHYNISXIKKS-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|