C25H26O6S — CID 170021269
3-[4,6-dimethoxy-7-(2-methylprop-2-enoyloxy)dibenzothiophen-3-yl]propyl 2-methylprop-2-enoate (PubChem CID 170021269) has the molecular formula C25H26O6S and a molecular weight of 454.54 g/mol. Its IUPAC name is 3-[4,6-dimethoxy-7-(2-methylprop-2-enoyloxy)dibenzothiophen-3-yl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[4,6-dimethoxy-7-(2-methylprop-2-enoyloxy)dibenzothiophen-3-yl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 170021269 |
| Molecular Formula | C25H26O6S |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 3-[4,6-dimethoxy-7-(2-methylprop-2-enoyloxy)dibenzothiophen-3-yl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1ccc2c(sc3c(OC)c(OC(=O)C(=C)C)ccc32)c1OC |
| InChI | InChI=1S/C25H26O6S/c1-14(2)24(26)30-13-7-8-16-9-10-17-18-11-12-19(31-25(27)15(3)4)21(29-6)23(18)32-22(17)20(16)28-5/h9-12H,1,3,7-8,13H2,2,4-6H3 |
| InChIKey | GOZIIGKYCUSMDB-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|