C24H21F3O4S — CID 170020858
3-[7-(2-methylprop-2-enoyloxy)-4-(trifluoromethyl)dibenzothiophen-3-yl]propyl 2-methylprop-2-enoate (PubChem CID 170020858) has the molecular formula C24H21F3O4S and a molecular weight of 462.49 g/mol. Its IUPAC name is 3-[7-(2-methylprop-2-enoyloxy)-4-(trifluoromethyl)dibenzothiophen-3-yl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[7-(2-methylprop-2-enoyloxy)-4-(trifluoromethyl)dibenzothiophen-3-yl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 170020858 |
| Molecular Formula | C24H21F3O4S |
| Molecular Weight | 462.49 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 3-[7-(2-methylprop-2-enoyloxy)-4-(trifluoromethyl)dibenzothiophen-3-yl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1ccc2c(sc3cc(OC(=O)C(=C)C)ccc32)c1C(F)(F)F |
| InChI | InChI=1S/C24H21F3O4S/c1-13(2)22(28)30-11-5-6-15-7-9-18-17-10-8-16(31-23(29)14(3)4)12-19(17)32-21(18)20(15)24(25,26)27/h7-10,12H,1,3,5-6,11H2,2,4H3 |
| InChIKey | WXYBKRRQGABONB-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.49 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|