C26H28O4 — CID 123815612
[7-[3-(2-methylprop-2-enoyloxy)propyl]phenanthren-2-yl] 2,2-dimethylpropanoate (PubChem CID 123815612) has the molecular formula C26H28O4 and a molecular weight of 404.51 g/mol. Its IUPAC name is [7-[3-(2-methylprop-2-enoyloxy)propyl]phenanthren-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [7-[3-(2-methylprop-2-enoyloxy)propyl]phenanthren-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 123815612 |
| Molecular Formula | C26H28O4 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | [7-[3-(2-methylprop-2-enoyloxy)propyl]phenanthren-2-yl] 2,2-dimethylpropanoate |
| SMILES | C=C(C)C(=O)OCCCc1ccc2c(ccc3cc(OC(=O)C(C)(C)C)ccc32)c1 |
| InChI | InChI=1S/C26H28O4/c1-17(2)24(27)29-14-6-7-18-8-12-22-19(15-18)9-10-20-16-21(11-13-23(20)22)30-25(28)26(3,4)5/h8-13,15-16H,1,6-7,14H2,2-5H3 |
| InChIKey | IXZJJKRRUCFJFT-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|