C26H29N3O7 — CID 59858153
[8-[2-hydroxy-5-[3-[2-(2-methylprop-2-enoyloxy)ethoxy]-3-oxopropyl]phenyl]-7,8,9-triazatricyclo[4.3.0.07,9]nona-1(6),2,4-trien-3-yl] 2,2-dimethylpropanoate (PubChem CID 59858153) has the molecular formula C26H29N3O7 and a molecular weight of 495.53 g/mol. Its IUPAC name is [8-[2-hydroxy-5-[3-[2-(2-methylprop-2-enoyloxy)ethoxy]-3-oxopropyl]phenyl]-7,8,9-triazatricyclo[4.3.0.07,9]nona-1(6),2,4-trien-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [8-[2-hydroxy-5-[3-[2-(2-methylprop-2-enoyloxy)ethoxy]-3-oxopropyl]phenyl]-7,8,9-triazatricyclo[4.3.0.07,9]nona-1(6),2,4-trien-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 59858153 |
| Molecular Formula | C26H29N3O7 |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | [8-[2-hydroxy-5-[3-[2-(2-methylprop-2-enoyloxy)ethoxy]-3-oxopropyl]phenyl]-7,8,9-triazatricyclo[4.3.0.07,9]nona-1(6),2,4-trien-3-yl] 2,2-dimethylpropanoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)CCc1ccc(O)c(-n2n3c4ccc(OC(=O)C(C)(C)C)cc4n23)c1 |
| InChI | InChI=1S/C26H29N3O7/c1-16(2)24(32)35-13-12-34-23(31)11-7-17-6-10-22(30)21(14-17)29-27-19-9-8-18(15-20(19)28(27)29)36-25(33)26(3,4)5/h6,8-10,14-15,30H,1,7,11-13H2,2-5H3 |
| InChIKey | WQQCIXAGPVSGOE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 112.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|