C18H16ClN3O4 — CID 21301778
2-[4-(3-chloro-7,8,9-triazatricyclo[4.3.0.07,9]nona-1(6),2,4-trien-8-yl)-3-hydroxyphenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 21301778) has the molecular formula C18H16ClN3O4 and a molecular weight of 373.80 g/mol. Its IUPAC name is 2-[4-(3-chloro-7,8,9-triazatricyclo[4.3.0.07,9]nona-1(6),2,4-trien-8-yl)-3-hydroxyphenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-(3-chloro-7,8,9-triazatricyclo[4.3.0.07,9]nona-1(6),2,4-trien-8-yl)-3-hydroxyphenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 21301778 |
| Molecular Formula | C18H16ClN3O4 |
| Molecular Weight | 373.80 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 2-[4-(3-chloro-7,8,9-triazatricyclo[4.3.0.07,9]nona-1(6),2,4-trien-8-yl)-3-hydroxyphenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1ccc(-n2n3c4ccc(Cl)cc4n23)c(O)c1 |
| InChI | InChI=1S/C18H16ClN3O4/c1-11(2)18(24)26-8-7-25-13-4-6-15(17(23)10-13)21-20-14-5-3-12(19)9-16(14)22(20)21/h3-6,9-10,23H,1,7-8H2,2H3 |
| InChIKey | VIOAKLSACXSACT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 69.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.80 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|