C29H30N4O5 — CID 58969645
2-[4-[[8-(5-tert-butyl-2-hydroxyphenyl)-7,8,9-triazatricyclo[4.3.0.07,9]nona-1(6),2,4-triene-3-carbonyl]amino]phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 58969645) has the molecular formula C29H30N4O5 and a molecular weight of 514.58 g/mol. Its IUPAC name is 2-[4-[[8-(5-tert-butyl-2-hydroxyphenyl)-7,8,9-triazatricyclo[4.3.0.07,9]nona-1(6),2,4-triene-3-carbonyl]amino]phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[[8-(5-tert-butyl-2-hydroxyphenyl)-7,8,9-triazatricyclo[4.3.0.07,9]nona-1(6),2,4-triene-3-carbonyl]amino]phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58969645 |
| Molecular Formula | C29H30N4O5 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | 2-[4-[[8-(5-tert-butyl-2-hydroxyphenyl)-7,8,9-triazatricyclo[4.3.0.07,9]nona-1(6),2,4-triene-3-carbonyl]amino]phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1ccc(NC(=O)c2ccc3c(c2)n2n(-c4cc(C(C)(C)C)ccc4O)n32)cc1 |
| InChI | InChI=1S/C29H30N4O5/c1-18(2)28(36)38-15-14-37-22-10-8-21(9-11-22)30-27(35)19-6-12-23-24(16-19)32-31(23)33(32)25-17-20(29(3,4)5)7-13-26(25)34/h6-13,16-17,34H,1,14-15H2,2-5H3,(H,30,35) |
| InChIKey | NDAYDNFRXNCGDK-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 98.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|