C13H17NO4 — CID 143071517
3-(4-amino-3-hydroxyphenoxy)propyl 2-methylprop-2-enoate (PubChem CID 143071517) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is 3-(4-amino-3-hydroxyphenoxy)propyl 2-methylprop-2-enoate.
| Compound Name | 3-(4-amino-3-hydroxyphenoxy)propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 143071517 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 3-(4-amino-3-hydroxyphenoxy)propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCOc1ccc(N)c(O)c1 |
| InChI | InChI=1S/C13H17NO4/c1-9(2)13(16)18-7-3-6-17-10-4-5-11(14)12(15)8-10/h4-5,8,15H,1,3,6-7,14H2,2H3 |
| InChIKey | LAGJAIAIYFAIPR-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|