C15H21NO4 — CID 143071513
3-(4-amino-3-hydroxy-2,6-dimethylphenoxy)propyl 2-methylprop-2-enoate (PubChem CID 143071513) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is 3-(4-amino-3-hydroxy-2,6-dimethylphenoxy)propyl 2-methylprop-2-enoate.
| Compound Name | 3-(4-amino-3-hydroxy-2,6-dimethylphenoxy)propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 143071513 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 3-(4-amino-3-hydroxy-2,6-dimethylphenoxy)propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCOc1c(C)cc(N)c(O)c1C |
| InChI | InChI=1S/C15H21NO4/c1-9(2)15(18)20-7-5-6-19-14-10(3)8-12(16)13(17)11(14)4/h8,17H,1,5-7,16H2,2-4H3 |
| InChIKey | HJNTVZPMIBILHH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|