C21H24O5 — CID 154932481
3-[4-(4-methoxy-3-methylphenoxy)phenoxy]propyl 2-methylprop-2-enoate (PubChem CID 154932481) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is 3-[4-(4-methoxy-3-methylphenoxy)phenoxy]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[4-(4-methoxy-3-methylphenoxy)phenoxy]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 154932481 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 3-[4-(4-methoxy-3-methylphenoxy)phenoxy]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCOc1ccc(Oc2ccc(OC)c(C)c2)cc1 |
| InChI | InChI=1S/C21H24O5/c1-15(2)21(22)25-13-5-12-24-17-6-8-18(9-7-17)26-19-10-11-20(23-4)16(3)14-19/h6-11,14H,1,5,12-13H2,2-4H3 |
| InChIKey | XWTLSIVOPXDCLH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|