C17H22O7S — CID 170058324
3-[2-(4-methoxy-3-methylphenyl)-2-oxoethoxy]sulfonylpropyl 2-methylprop-2-enoate (PubChem CID 170058324) has the molecular formula C17H22O7S and a molecular weight of 370.42 g/mol. Its IUPAC name is 3-[2-(4-methoxy-3-methylphenyl)-2-oxoethoxy]sulfonylpropyl 2-methylprop-2-enoate.
| Compound Name | 3-[2-(4-methoxy-3-methylphenyl)-2-oxoethoxy]sulfonylpropyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 170058324 |
| Molecular Formula | C17H22O7S |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 3-[2-(4-methoxy-3-methylphenyl)-2-oxoethoxy]sulfonylpropyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCS(=O)(=O)OCC(=O)c1ccc(OC)c(C)c1 |
| InChI | InChI=1S/C17H22O7S/c1-12(2)17(19)23-8-5-9-25(20,21)24-11-15(18)14-6-7-16(22-4)13(3)10-14/h6-7,10H,1,5,8-9,11H2,2-4H3 |
| InChIKey | MNCRFTALDQQPDX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|